C16H19FN2O2S — CID 155987574
(4S,5S)-5-(2-fluorophenoxy)-1-(1,3-thiazol-4-ylmethyl)azepan-4-ol (PubChem CID 155987574) has the molecular formula C16H19FN2O2S and a molecular weight of 322.40 g/mol. Its IUPAC name is (4S,5S)-5-(2-fluorophenoxy)-1-(1,3-thiazol-4-ylmethyl)azepan-4-ol.
| Compound Name | (4S,5S)-5-(2-fluorophenoxy)-1-(1,3-thiazol-4-ylmethyl)azepan-4-ol |
|---|---|
| PubChem CID | 155987574 |
| Molecular Formula | C16H19FN2O2S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (4S,5S)-5-(2-fluorophenoxy)-1-(1,3-thiazol-4-ylmethyl)azepan-4-ol |
| SMILES | O[C@H]1CCN(Cc2cscn2)CC[C@@H]1Oc1ccccc1F |
| InChI | InChI=1S/C16H19FN2O2S/c17-13-3-1-2-4-15(13)21-16-6-8-19(7-5-14(16)20)9-12-10-22-11-18-12/h1-4,10-11,14,16,20H,5-9H2/t14-,16-/m0/s1 |
| InChIKey | FYNWQDBPVZTCSS-HOCLYGCPSA-N |
| XLogP | 2.69 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |