C17H28N2O4S — CID 155994826
(3R,4S)-1-(benzenesulfonyl)-3-[(pentan-3-ylamino)methyl]piperidine-3,4-diol (PubChem CID 155994826) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is (3R,4S)-1-(benzenesulfonyl)-3-[(pentan-3-ylamino)methyl]piperidine-3,4-diol.
| Compound Name | (3R,4S)-1-(benzenesulfonyl)-3-[(pentan-3-ylamino)methyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 155994826 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (3R,4S)-1-(benzenesulfonyl)-3-[(pentan-3-ylamino)methyl]piperidine-3,4-diol |
| SMILES | CCC(CC)NC[C@@]1(O)CN(S(=O)(=O)c2ccccc2)CC[C@@H]1O |
| InChI | InChI=1S/C17H28N2O4S/c1-3-14(4-2)18-12-17(21)13-19(11-10-16(17)20)24(22,23)15-8-6-5-7-9-15/h5-9,14,16,18,20-21H,3-4,10-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | HOMDRWOXOKSQFK-DLBZAZTESA-N |
| XLogP | 0.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |