C33H44N4O7 — CID 155995966
(7S,11S)-7-benzyl-5-butyl-6,9,13-trioxo-N-[2-(oxolan-2-ylmethoxy)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 155995966) has the molecular formula C33H44N4O7 and a molecular weight of 608.74 g/mol. Its IUPAC name is (7S,11S)-7-benzyl-5-butyl-6,9,13-trioxo-N-[2-(oxolan-2-ylmethoxy)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-7-benzyl-5-butyl-6,9,13-trioxo-N-[2-(oxolan-2-ylmethoxy)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 155995966 |
| Molecular Formula | C33H44N4O7 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | (7S,11S)-7-benzyl-5-butyl-6,9,13-trioxo-N-[2-(oxolan-2-ylmethoxy)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CCCCN1CCOc2ccccc2C(=O)N[C@H](C(=O)NCCOCC2CCCO2)CC(=O)N[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C33H44N4O7/c1-2-3-16-37-17-20-44-29-14-8-7-13-26(29)31(39)36-27(32(40)34-15-19-42-23-25-12-9-18-43-25)22-30(38)35-28(33(37)41)21-24-10-5-4-6-11-24/h4-8,10-11,13-14,25,27-28H,2-3,9,12,15-23H2,1H3,(H,34,40)(H,35,38)(H,36,39)/t25?,27-,28-/m0/s1 |
| InChIKey | LDNZBPUMHIOOGL-UXXOXOCRSA-N |
| XLogP | 2.24 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|