C23H37N3O7 — CID 155997236
1-[(11S,12R,13R)-11,12,13-trihydroxy-6-[4-[2-(methylamino)ethoxy]benzoyl]-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone (PubChem CID 155997236) has the molecular formula C23H37N3O7 and a molecular weight of 467.56 g/mol. Its IUPAC name is 1-[(11S,12R,13R)-11,12,13-trihydroxy-6-[4-[2-(methylamino)ethoxy]benzoyl]-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone.
| Compound Name | 1-[(11S,12R,13R)-11,12,13-trihydroxy-6-[4-[2-(methylamino)ethoxy]benzoyl]-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone |
|---|---|
| PubChem CID | 155997236 |
| Molecular Formula | C23H37N3O7 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 1-[(11S,12R,13R)-11,12,13-trihydroxy-6-[4-[2-(methylamino)ethoxy]benzoyl]-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone |
| SMILES | CNCCOc1ccc(C(=O)N2CCCCOC[C@@H](O)[C@H](O)[C@@H](O)CN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C23H37N3O7/c1-17(27)26-12-11-25(10-3-4-13-32-16-21(29)22(30)20(28)15-26)23(31)18-5-7-19(8-6-18)33-14-9-24-2/h5-8,20-22,24,28-30H,3-4,9-16H2,1-2H3/t20-,21+,22+/m0/s1 |
| InChIKey | USXWSJCGRLNJSO-BHDDXSALSA-N |
| XLogP | -0.53 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|