C24H39N3O7 — CID 155997238
1-[(11S,12R,13R)-6-[4-[2-(dimethylamino)ethoxy]benzoyl]-11,12,13-trihydroxy-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone (PubChem CID 155997238) has the molecular formula C24H39N3O7 and a molecular weight of 481.59 g/mol. Its IUPAC name is 1-[(11S,12R,13R)-6-[4-[2-(dimethylamino)ethoxy]benzoyl]-11,12,13-trihydroxy-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone.
| Compound Name | 1-[(11S,12R,13R)-6-[4-[2-(dimethylamino)ethoxy]benzoyl]-11,12,13-trihydroxy-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone |
|---|---|
| PubChem CID | 155997238 |
| Molecular Formula | C24H39N3O7 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 1-[(11S,12R,13R)-6-[4-[2-(dimethylamino)ethoxy]benzoyl]-11,12,13-trihydroxy-1-oxa-6,9-diazacyclotetradec-9-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2ccc(OCCN(C)C)cc2)CCCCOC[C@@H](O)[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C24H39N3O7/c1-18(28)27-12-11-26(10-4-5-14-33-17-22(30)23(31)21(29)16-27)24(32)19-6-8-20(9-7-19)34-15-13-25(2)3/h6-9,21-23,29-31H,4-5,10-17H2,1-3H3/t21-,22+,23+/m0/s1 |
| InChIKey | GSXDEAIIWQOPIV-YTFSRNRJSA-N |
| XLogP | -0.19 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |