C22H24F2N2O — CID 155999241
[(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-fluorophenyl)methanone (PubChem CID 155999241) has the molecular formula C22H24F2N2O and a molecular weight of 370.44 g/mol. Its IUPAC name is [(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 155999241 |
| Molecular Formula | C22H24F2N2O |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-fluorophenyl)methanone |
| SMILES | CC1(C)C[C@H]2[C@H](CCCN2C(=O)c2ccccc2F)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24F2N2O/c1-22(2)14-20-19(26(22)16-11-9-15(23)10-12-16)8-5-13-25(20)21(27)17-6-3-4-7-18(17)24/h3-4,6-7,9-12,19-20H,5,8,13-14H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | WJDKRUMMMYLSSJ-PMACEKPBSA-N |
| XLogP | 4.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |