C20H24ClFN4O — CID 155999258
[(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone (PubChem CID 155999258) has the molecular formula C20H24ClFN4O and a molecular weight of 390.89 g/mol. Its IUPAC name is [(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone.
| Compound Name | [(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 155999258 |
| Molecular Formula | C20H24ClFN4O |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone |
| SMILES | Cn1ncc(Cl)c1C(=O)N1CCC[C@H]2[C@@H]1CC(C)(C)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24ClFN4O/c1-20(2)11-17-16(26(20)14-8-6-13(22)7-9-14)5-4-10-25(17)19(27)18-15(21)12-23-24(18)3/h6-9,12,16-17H,4-5,10-11H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | KGXJEOPRLQTIBA-IRXDYDNUSA-N |
| XLogP | 3.87 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |