C20H25FN4O — CID 155999796
[(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 155999796) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is [(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 155999796 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1CCC[C@H]2[C@@H]1CC(C)(C)N2c1cccc(F)c1 |
| InChI | InChI=1S/C20H25FN4O/c1-20(2)13-18-16(25(20)15-7-4-6-14(21)12-15)8-5-11-24(18)19(26)17-9-10-22-23(17)3/h4,6-7,9-10,12,16,18H,5,8,11,13H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | NTEFUZQGUDNDGE-WMZOPIPTSA-N |
| XLogP | 3.22 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |