C23H26F2N2O — CID 155999829
1-[(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-(3-fluorophenyl)ethanone (PubChem CID 155999829) has the molecular formula C23H26F2N2O and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-[(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-[(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 155999829 |
| Molecular Formula | C23H26F2N2O |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-(3-fluorophenyl)ethanone |
| SMILES | CC1(C)C[C@H]2[C@H](CCCN2C(=O)Cc2cccc(F)c2)N1c1cccc(F)c1 |
| InChI | InChI=1S/C23H26F2N2O/c1-23(2)15-21-20(27(23)19-9-4-8-18(25)14-19)10-5-11-26(21)22(28)13-16-6-3-7-17(24)12-16/h3-4,6-9,12,14,20-21H,5,10-11,13,15H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | ZUJWHUIQJNDQGE-SFTDATJTSA-N |
| XLogP | 4.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |