C22H29FN4O — CID 155999851
[(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(1-propylpyrazol-4-yl)methanone (PubChem CID 155999851) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is [(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(1-propylpyrazol-4-yl)methanone.
| Compound Name | [(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 155999851 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(3aS,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-(1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1cc(C(=O)N2CCC[C@H]3[C@@H]2CC(C)(C)N3c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C22H29FN4O/c1-4-10-25-15-16(14-24-25)21(28)26-11-6-9-19-20(26)13-22(2,3)27(19)18-8-5-7-17(23)12-18/h5,7-8,12,14-15,19-20H,4,6,9-11,13H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | AGBKWLLRWXGZNT-PMACEKPBSA-N |
| XLogP | 4.09 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |