C21H31FN2O — CID 155999207
1-[(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-ethylbutan-1-one (PubChem CID 155999207) has the molecular formula C21H31FN2O and a molecular weight of 346.49 g/mol. Its IUPAC name is 1-[(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 155999207 |
| Molecular Formula | C21H31FN2O |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[(3aS,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CCC[C@H]2[C@@H]1CC(C)(C)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C21H31FN2O/c1-5-15(6-2)20(25)23-13-7-8-18-19(23)14-21(3,4)24(18)17-11-9-16(22)10-12-17/h9-12,15,18-19H,5-8,13-14H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | IIRVGBZQLGHVAH-OALUTQOASA-N |
| XLogP | 4.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |