C22H32FN3O — CID 155999295
1-[(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-piperidin-1-ylethanone (PubChem CID 155999295) has the molecular formula C22H32FN3O and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-piperidin-1-ylethanone.
| Compound Name | 1-[(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 155999295 |
| Molecular Formula | C22H32FN3O |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-[(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-piperidin-1-ylethanone |
| SMILES | CC1(C)C[C@@H]2CN(C(=O)CN3CCCCC3)CC[C@@H]2N1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H32FN3O/c1-22(2)14-17-15-25(21(27)16-24-11-4-3-5-12-24)13-10-20(17)26(22)19-8-6-18(23)7-9-19/h6-9,17,20H,3-5,10-16H2,1-2H3/t17-,20+/m1/s1 |
| InChIKey | HKGVHCDJYVSRCD-XLIONFOSSA-N |
| XLogP | 3.52 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |