C24H28F2N2O — CID 155999949
1-[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-3-(2-fluorophenyl)propan-1-one (PubChem CID 155999949) has the molecular formula C24H28F2N2O and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-3-(2-fluorophenyl)propan-1-one.
| Compound Name | 1-[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-3-(2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 155999949 |
| Molecular Formula | C24H28F2N2O |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-3-(2-fluorophenyl)propan-1-one |
| SMILES | CC1(C)C[C@@H]2CN(C(=O)CCc3ccccc3F)CC[C@@H]2N1c1cccc(F)c1 |
| InChI | InChI=1S/C24H28F2N2O/c1-24(2)15-18-16-27(23(29)11-10-17-6-3-4-9-21(17)26)13-12-22(18)28(24)20-8-5-7-19(25)14-20/h3-9,14,18,22H,10-13,15-16H2,1-2H3/t18-,22+/m1/s1 |
| InChIKey | VYLNQUJYCDYDLX-GCJKJVERSA-N |
| XLogP | 4.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |