C22H23F3N2O — CID 155999867
[(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,5-difluorophenyl)methanone (PubChem CID 155999867) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,5-difluorophenyl)methanone.
| Compound Name | [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 155999867 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [(3aR,7aS)-1-(3-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-(2,5-difluorophenyl)methanone |
| SMILES | CC1(C)C[C@@H]2CN(C(=O)c3cc(F)ccc3F)CC[C@@H]2N1c1cccc(F)c1 |
| InChI | InChI=1S/C22H23F3N2O/c1-22(2)12-14-13-26(21(28)18-11-16(24)6-7-19(18)25)9-8-20(14)27(22)17-5-3-4-15(23)10-17/h3-7,10-11,14,20H,8-9,12-13H2,1-2H3/t14-,20+/m1/s1 |
| InChIKey | ALLJBUSYROCMGQ-VLIAUNLRSA-N |
| XLogP | 4.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |