C13H18ClFN2O — CID 15604680
(3S)-N-(3-chloro-4-fluorophenyl)-N-(2-methoxyethyl)pyrrolidin-3-amine (PubChem CID 15604680) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-fluorophenyl)-N-(2-methoxyethyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-(3-chloro-4-fluorophenyl)-N-(2-methoxyethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 15604680 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (3S)-N-(3-chloro-4-fluorophenyl)-N-(2-methoxyethyl)pyrrolidin-3-amine |
| SMILES | COCCN(c1ccc(F)c(Cl)c1)[C@H]1CCNC1 |
| InChI | InChI=1S/C13H18ClFN2O/c1-18-7-6-17(11-4-5-16-9-11)10-2-3-13(15)12(14)8-10/h2-3,8,11,16H,4-7,9H2,1H3/t11-/m0/s1 |
| InChIKey | UNEZVEUPNRSKAY-NSHDSACASA-N |
| XLogP | 2.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |