C14H21Cl2FN2S — CID 66657175
(3S)-N-(3-chloro-4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 66657175) has the molecular formula C14H21Cl2FN2S and a molecular weight of 339.31 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-N-(3-chloro-4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 66657175 |
| Molecular Formula | C14H21Cl2FN2S |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (3S)-N-(3-chloro-4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | CSCCCN(c1ccc(F)c(Cl)c1)[C@H]1CCNC1.Cl |
| InChI | InChI=1S/C14H20ClFN2S.ClH/c1-19-8-2-7-18(12-5-6-17-10-12)11-3-4-14(16)13(15)9-11;/h3-4,9,12,17H,2,5-8,10H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | VWTWEYGFGOFAQJ-YDALLXLXSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|