C15H14ClF2N3 — CID 15604599
N-(3-chloro-4-fluorophenyl)-5-fluoro-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine (PubChem CID 15604599) has the molecular formula C15H14ClF2N3 and a molecular weight of 309.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-fluoro-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-fluoro-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 15604599 |
| Molecular Formula | C15H14ClF2N3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-fluoro-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine |
| SMILES | Fc1cncc(N(c2ccc(F)c(Cl)c2)[C@H]2CCNC2)c1 |
| InChI | InChI=1S/C15H14ClF2N3/c16-14-6-11(1-2-15(14)18)21(12-3-4-19-8-12)13-5-10(17)7-20-9-13/h1-2,5-7,9,12,19H,3-4,8H2/t12-/m0/s1 |
| InChIKey | MBKIPIPJCGAWDI-LBPRGKRZSA-N |
| XLogP | 3.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |