C15H15Cl2N3 — CID 15604597
N-(3,4-dichlorophenyl)-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine (PubChem CID 15604597) has the molecular formula C15H15Cl2N3 and a molecular weight of 308.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine.
| Compound Name | N-(3,4-dichlorophenyl)-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 15604597 |
| Molecular Formula | C15H15Cl2N3 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine |
| SMILES | Clc1ccc(N(c2cccnc2)[C@H]2CCNC2)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3/c16-14-4-3-11(8-15(14)17)20(13-5-7-19-10-13)12-2-1-6-18-9-12/h1-4,6,8-9,13,19H,5,7,10H2/t13-/m0/s1 |
| InChIKey | AJRJSVVCJZGXMX-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |