C27H31ClFN3O9 — CID 66657214
bis(but-2-enedioic acid);N-(3-chloro-4-fluorophenyl)-N-(4-pyridin-2-yloxybutyl)pyrrolidin-3-amine (PubChem CID 66657214) has the molecular formula C27H31ClFN3O9 and a molecular weight of 596.01 g/mol. Its IUPAC name is bis(but-2-enedioic acid);N-(3-chloro-4-fluorophenyl)-N-(4-pyridin-2-yloxybutyl)pyrrolidin-3-amine.
| Compound Name | bis(but-2-enedioic acid);N-(3-chloro-4-fluorophenyl)-N-(4-pyridin-2-yloxybutyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 66657214 |
| Molecular Formula | C27H31ClFN3O9 |
| Molecular Weight | 596.01 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | bis(but-2-enedioic acid);N-(3-chloro-4-fluorophenyl)-N-(4-pyridin-2-yloxybutyl)pyrrolidin-3-amine |
| SMILES | Fc1ccc(N(CCCCOc2ccccn2)C2CCNC2)cc1Cl.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H23ClFN3O.2C4H4O4/c20-17-13-15(6-7-18(17)21)24(16-8-10-22-14-16)11-3-4-12-25-19-5-1-2-9-23-19;2*5-3(6)1-2-4(7)8/h1-2,5-7,9,13,16,22H,3-4,8,10-12,14H2;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | YWBQCIPKMTVSLY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.01 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|