C23H23FN2O — CID 15605657
(1S)-1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanol (PubChem CID 15605657) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is (1S)-1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanol.
| Compound Name | (1S)-1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 15605657 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (1S)-1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanol |
| SMILES | CC1=Cc2c(cnn2-c2ccc(F)cc2)CC1(C)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C23H23FN2O/c1-16-12-21-18(15-25-26(21)20-10-8-19(24)9-11-20)14-23(16,2)22(27)13-17-6-4-3-5-7-17/h3-12,15,22,27H,13-14H2,1-2H3/t22-,23?/m0/s1 |
| InChIKey | OGDGQKVRLHUKBJ-NQCNTLBGSA-N |
| XLogP | 4.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |