C23H21FN2 — CID 66919534
1-(4-fluorophenyl)-5,6-dimethyl-5-(2-phenylethenyl)-4H-indazole (PubChem CID 66919534) has the molecular formula C23H21FN2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5,6-dimethyl-5-(2-phenylethenyl)-4H-indazole.
| Compound Name | 1-(4-fluorophenyl)-5,6-dimethyl-5-(2-phenylethenyl)-4H-indazole |
|---|---|
| PubChem CID | 66919534 |
| Molecular Formula | C23H21FN2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-(4-fluorophenyl)-5,6-dimethyl-5-(2-phenylethenyl)-4H-indazole |
| SMILES | CC1=Cc2c(cnn2-c2ccc(F)cc2)CC1(C)C=Cc1ccccc1 |
| InChI | InChI=1S/C23H21FN2/c1-17-14-22-19(16-25-26(22)21-10-8-20(24)9-11-21)15-23(17,2)13-12-18-6-4-3-5-7-18/h3-14,16H,15H2,1-2H3 |
| InChIKey | BUPBFEAZQRKECM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |