C24H26FN3 — CID 66919606
N-benzyl-2-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]ethanamine (PubChem CID 66919606) has the molecular formula C24H26FN3 and a molecular weight of 375.49 g/mol. Its IUPAC name is N-benzyl-2-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]ethanamine.
| Compound Name | N-benzyl-2-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 66919606 |
| Molecular Formula | C24H26FN3 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-benzyl-2-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]ethanamine |
| SMILES | CC1=Cc2c(cnn2-c2ccc(F)cc2)CC1(C)CCNCc1ccccc1 |
| InChI | InChI=1S/C24H26FN3/c1-18-14-23-20(17-27-28(23)22-10-8-21(25)9-11-22)15-24(18,2)12-13-26-16-19-6-4-3-5-7-19/h3-11,14,17,26H,12-13,15-16H2,1-2H3 |
| InChIKey | WQMKEWJCXJRCLU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|