C23H21FN2O — CID 66919599
1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanone (PubChem CID 66919599) has the molecular formula C23H21FN2O and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 66919599 |
| Molecular Formula | C23H21FN2O |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-2-phenylethanone |
| SMILES | CC1=Cc2c(cnn2-c2ccc(F)cc2)CC1(C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H21FN2O/c1-16-12-21-18(15-25-26(21)20-10-8-19(24)9-11-20)14-23(16,2)22(27)13-17-6-4-3-5-7-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | DOVKRFDWVFHBDA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |