C30H29FN2O — CID 66919542
5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-6-phenyl-4H-indazole (PubChem CID 66919542) has the molecular formula C30H29FN2O and a molecular weight of 452.57 g/mol. Its IUPAC name is 5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-6-phenyl-4H-indazole.
| Compound Name | 5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-6-phenyl-4H-indazole |
|---|---|
| PubChem CID | 66919542 |
| Molecular Formula | C30H29FN2O |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-6-phenyl-4H-indazole |
| SMILES | CCO[C@H](CC1(C)Cc2cnn(-c3ccc(F)cc3)c2C=C1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29FN2O/c1-3-34-29(23-12-8-5-9-13-23)20-30(2)19-24-21-32-33(26-16-14-25(31)15-17-26)28(24)18-27(30)22-10-6-4-7-11-22/h4-18,21,29H,3,19-20H2,1-2H3/t29-,30?/m1/s1 |
| InChIKey | GWWSGODBBJLPAU-IDCGIGBZSA-N |
| XLogP | 7.28 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |