C24H25FN2O — CID 66919437
5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-4H-indazole (PubChem CID 66919437) has the molecular formula C24H25FN2O and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-4H-indazole.
| Compound Name | 5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-4H-indazole |
|---|---|
| PubChem CID | 66919437 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-[(2R)-2-ethoxy-2-phenylethyl]-1-(4-fluorophenyl)-5-methyl-4H-indazole |
| SMILES | CCO[C@H](CC1(C)C=Cc2c(cnn2-c2ccc(F)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C24H25FN2O/c1-3-28-23(18-7-5-4-6-8-18)16-24(2)14-13-22-19(15-24)17-26-27(22)21-11-9-20(25)10-12-21/h4-14,17,23H,3,15-16H2,1-2H3/t23-,24?/m1/s1 |
| InChIKey | WOPGZFODXFLDOL-MIHMCVIASA-N |
| XLogP | 5.75 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |