C25H27FN2O — CID 66919420
(2R)-1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-2-methyl-4-phenylbutan-2-ol (PubChem CID 66919420) has the molecular formula C25H27FN2O and a molecular weight of 390.50 g/mol. Its IUPAC name is (2R)-1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-2-methyl-4-phenylbutan-2-ol.
| Compound Name | (2R)-1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-2-methyl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 66919420 |
| Molecular Formula | C25H27FN2O |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2R)-1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-2-methyl-4-phenylbutan-2-ol |
| SMILES | CC1(C[C@](C)(O)CCc2ccccc2)C=Cc2c(cnn2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H27FN2O/c1-24(18-25(2,29)15-12-19-6-4-3-5-7-19)14-13-23-20(16-24)17-27-28(23)22-10-8-21(26)9-11-22/h3-11,13-14,17,29H,12,15-16,18H2,1-2H3/t24?,25-/m1/s1 |
| InChIKey | OVGMOHBTZNEVGE-WUBHUQEYSA-N |
| XLogP | 5.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |