C26H29FN2O — CID 66919562
1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-4-methyl-4-phenylpentan-2-ol (PubChem CID 66919562) has the molecular formula C26H29FN2O and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-4-methyl-4-phenylpentan-2-ol.
| Compound Name | 1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-4-methyl-4-phenylpentan-2-ol |
|---|---|
| PubChem CID | 66919562 |
| Molecular Formula | C26H29FN2O |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-5-methyl-4H-indazol-5-yl]-4-methyl-4-phenylpentan-2-ol |
| SMILES | CC1(CC(O)CC(C)(C)c2ccccc2)C=Cc2c(cnn2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H29FN2O/c1-25(2,20-7-5-4-6-8-20)16-23(30)17-26(3)14-13-24-19(15-26)18-28-29(24)22-11-9-21(27)10-12-22/h4-14,18,23,30H,15-17H2,1-3H3 |
| InChIKey | XVRSAGYGQPUPPC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |