C7F12O — CID 15606312
1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pent-1-ene (PubChem CID 15606312) has the molecular formula C7F12O and a molecular weight of 328.05 g/mol. Its IUPAC name is 1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pent-1-ene.
| Compound Name | 1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pent-1-ene |
|---|---|
| PubChem CID | 15606312 |
| Molecular Formula | C7F12O |
| Molecular Weight | 328.05 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pent-1-ene |
| SMILES | FC(F)=C(F)OC(F)(C(F)(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C7F12O/c8-1(2(9)10)5(14,15)6(16,7(17,18)19)20-4(13)3(11)12 |
| InChIKey | CQFRQNIHJCTFRW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|