C19H34O3Si — CID 15609449
tert-butyl-dimethyl-[(1R,4S)-4-[(2-methylpropan-2-yl)oxymethyl]-4-prop-2-ynoxycyclopent-2-en-1-yl]oxysilane (PubChem CID 15609449) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,4S)-4-[(2-methylpropan-2-yl)oxymethyl]-4-prop-2-ynoxycyclopent-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,4S)-4-[(2-methylpropan-2-yl)oxymethyl]-4-prop-2-ynoxycyclopent-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 15609449 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,4S)-4-[(2-methylpropan-2-yl)oxymethyl]-4-prop-2-ynoxycyclopent-2-en-1-yl]oxysilane |
| SMILES | C#CCO[C@]1(COC(C)(C)C)C=C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H34O3Si/c1-10-13-20-19(15-21-17(2,3)4)12-11-16(14-19)22-23(8,9)18(5,6)7/h1,11-12,16H,13-15H2,2-9H3/t16-,19+/m0/s1 |
| InChIKey | OGQJTOBDTNOWQG-QFBILLFUSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|