C17H32O3Si2 — CID 101115183
(1R,4R,5S)-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethynyl)-5-trimethylsilyloxycyclopent-2-en-1-ol (PubChem CID 101115183) has the molecular formula C17H32O3Si2 and a molecular weight of 340.61 g/mol. Its IUPAC name is (1R,4R,5S)-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethynyl)-5-trimethylsilyloxycyclopent-2-en-1-ol.
| Compound Name | (1R,4R,5S)-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethynyl)-5-trimethylsilyloxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 101115183 |
| Molecular Formula | C17H32O3Si2 |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (1R,4R,5S)-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethynyl)-5-trimethylsilyloxycyclopent-2-en-1-ol |
| SMILES | CC(C)(C)O[C@@H]1C=C[C@@](O)(C#C[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H32O3Si2/c1-16(2,3)19-14-10-11-17(18,12-13-21(4,5)6)15(14)20-22(7,8)9/h10-11,14-15,18H,1-9H3/t14-,15+,17-/m1/s1 |
| InChIKey | CTLNDYSTVZSWRU-HLLBOEOZSA-N |
| XLogP | 3.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|