C21H36O2Si — CID 11717248
(1S)-1-[(2S,5R)-5-[5-tri(propan-2-yl)silylpent-4-ynyl]-2,5-dihydrofuran-2-yl]prop-2-en-1-ol (PubChem CID 11717248) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (1S)-1-[(2S,5R)-5-[5-tri(propan-2-yl)silylpent-4-ynyl]-2,5-dihydrofuran-2-yl]prop-2-en-1-ol.
| Compound Name | (1S)-1-[(2S,5R)-5-[5-tri(propan-2-yl)silylpent-4-ynyl]-2,5-dihydrofuran-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11717248 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (1S)-1-[(2S,5R)-5-[5-tri(propan-2-yl)silylpent-4-ynyl]-2,5-dihydrofuran-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@H](O)[C@@H]1C=C[C@@H](CCCC#C[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C21H36O2Si/c1-8-20(22)21-14-13-19(23-21)12-10-9-11-15-24(16(2)3,17(4)5)18(6)7/h8,13-14,16-22H,1,9-10,12H2,2-7H3/t19-,20+,21+/m1/s1 |
| InChIKey | ZDAIPBVCLFCTMA-HKBOAZHASA-N |
| XLogP | 5.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|