C19H30O6 — CID 15621808
diethyl 2-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl]propanedioate (PubChem CID 15621808) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is diethyl 2-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl]propanedioate.
| Compound Name | diethyl 2-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl]propanedioate |
|---|---|
| PubChem CID | 15621808 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | diethyl 2-[(2E,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl]propanedioate |
| SMILES | CCOC(=O)C(C/C(C)=C/CC/C(C)=C/COC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H30O6/c1-6-23-18(21)17(19(22)24-7-2)13-15(4)10-8-9-14(3)11-12-25-16(5)20/h10-11,17H,6-9,12-13H2,1-5H3/b14-11+,15-10+ |
| InChIKey | SARLCVWGWUDVGN-QYFSLLALSA-N |
| XLogP | 3.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|