About O-methyl 2-phenylethaneselenoate
O-methyl 2-phenylethaneselenoate (PubChem CID 15646646) has the molecular formula C9H10OSe
and a molecular weight of 213.14 g/mol. Its IUPAC name is O-methyl 2-phenylethaneselenoate.
Molecular Properties
| Compound Name | O-methyl 2-phenylethaneselenoate |
| PubChem CID | 15646646 |
| Molecular Formula | C9H10OSe |
| Molecular Weight | 213.14 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | O-methyl 2-phenylethaneselenoate |
| SMILES | COC(=[Se])Cc1ccccc1 |
| InChI | InChI=1S/C9H10OSe/c1-10-9(11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | TVHCIWADHTZMKU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze O-methyl 2-phenylethaneselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl 2-phenylethaneselenoate?
The IUPAC name of O-methyl 2-phenylethaneselenoate (CID 15646646) is O-methyl 2-phenylethaneselenoate.
What is the SMILES notation for O-methyl 2-phenylethaneselenoate?
The canonical SMILES for O-methyl 2-phenylethaneselenoate is COC(=[Se])Cc1ccccc1.
What is the InChIKey of O-methyl 2-phenylethaneselenoate?
The InChIKey is TVHCIWADHTZMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OSe/c1-10-9(11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of O-methyl 2-phenylethaneselenoate?
O-methyl 2-phenylethaneselenoate has a molecular weight of 213.14 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl 2-phenylethaneselenoate is sourced from PubChem (CID 15646646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).