C21H18ClF2N3O4 — CID 156504337
3-(3-chloro-4-methoxyphenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methylurea (PubChem CID 156504337) has the molecular formula C21H18ClF2N3O4 and a molecular weight of 449.84 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methylurea.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methylurea |
|---|---|
| PubChem CID | 156504337 |
| Molecular Formula | C21H18ClF2N3O4 |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)[C@@H]2COCc3[nH]c(=O)c4cc(F)c(F)cc4c32)cc1Cl |
| InChI | InChI=1S/C21H18ClF2N3O4/c1-27(21(29)25-10-3-4-18(30-2)13(22)5-10)17-9-31-8-16-19(17)11-6-14(23)15(24)7-12(11)20(28)26-16/h3-7,17H,8-9H2,1-2H3,(H,25,29)(H,26,28)/t17-/m1/s1 |
| InChIKey | XGSYTOPAJUKUGM-QGZVFWFLSA-N |
| XLogP | 4.20 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |