C20H14F5N3O3 — CID 156504685
1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methyl-3-(3,4,5-trifluorophenyl)urea (PubChem CID 156504685) has the molecular formula C20H14F5N3O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is 1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methyl-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methyl-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 156504685 |
| Molecular Formula | C20H14F5N3O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-methyl-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CN(C(=O)Nc1cc(F)c(F)c(F)c1)[C@@H]1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C20H14F5N3O3/c1-28(20(30)26-8-2-13(23)18(25)14(24)3-8)16-7-31-6-15-17(16)9-4-11(21)12(22)5-10(9)19(29)27-15/h2-5,16H,6-7H2,1H3,(H,26,30)(H,27,29)/t16-/m1/s1 |
| InChIKey | OQRGNWRXVLUVPQ-MRXNPFEDSA-N |
| XLogP | 3.96 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|