C21H18F3N3O3 — CID 156504518
1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-3-(4-fluoro-3-methylphenyl)-1-methylurea (PubChem CID 156504518) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-3-(4-fluoro-3-methylphenyl)-1-methylurea.
| Compound Name | 1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-3-(4-fluoro-3-methylphenyl)-1-methylurea |
|---|---|
| PubChem CID | 156504518 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-3-(4-fluoro-3-methylphenyl)-1-methylurea |
| SMILES | Cc1cc(NC(=O)N(C)[C@H]2COCc3[nH]c(=O)c4cc(F)c(F)cc4c32)ccc1F |
| InChI | InChI=1S/C21H18F3N3O3/c1-10-5-11(3-4-14(10)22)25-21(29)27(2)18-9-30-8-17-19(18)12-6-15(23)16(24)7-13(12)20(28)26-17/h3-7,18H,8-9H2,1-2H3,(H,25,29)(H,26,28)/t18-/m0/s1 |
| InChIKey | OCUXGNPCNQAHTR-SFHVURJKSA-N |
| XLogP | 3.99 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |