C20H15Cl2F2N3O3 — CID 156504503
3-(3,5-dichloro-4-fluorophenyl)-1-(8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-1-methylurea (PubChem CID 156504503) has the molecular formula C20H15Cl2F2N3O3 and a molecular weight of 454.26 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluorophenyl)-1-(8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-1-methylurea.
| Compound Name | 3-(3,5-dichloro-4-fluorophenyl)-1-(8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-1-methylurea |
|---|---|
| PubChem CID | 156504503 |
| Molecular Formula | C20H15Cl2F2N3O3 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 3-(3,5-dichloro-4-fluorophenyl)-1-(8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-1-methylurea |
| SMILES | CN(C(=O)Nc1cc(Cl)c(F)c(Cl)c1)C1COCc2[nH]c(=O)c3cc(F)ccc3c21 |
| InChI | InChI=1S/C20H15Cl2F2N3O3/c1-27(20(29)25-10-5-13(21)18(24)14(22)6-10)16-8-30-7-15-17(16)11-3-2-9(23)4-12(11)19(28)26-15/h2-6,16H,7-8H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | RYBWBFUHLFPRNM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|