C23H21F4N3O3 — CID 156504452
1-[(1S)-8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)-3-(3,4,5-trifluorophenyl)urea (PubChem CID 156504452) has the molecular formula C23H21F4N3O3 and a molecular weight of 463.43 g/mol. Its IUPAC name is 1-[(1S)-8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[(1S)-8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 156504452 |
| Molecular Formula | C23H21F4N3O3 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 1-[(1S)-8-fluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CC(C)CN(C(=O)Nc1cc(F)c(F)c(F)c1)[C@@H]1COCc2[nH]c(=O)c3cc(F)ccc3c21 |
| InChI | InChI=1S/C23H21F4N3O3/c1-11(2)8-30(23(32)28-13-6-16(25)21(27)17(26)7-13)19-10-33-9-18-20(19)14-4-3-12(24)5-15(14)22(31)29-18/h3-7,11,19H,8-10H2,1-2H3,(H,28,32)(H,29,31)/t19-/m1/s1 |
| InChIKey | REBNSCKSPQTBIX-LJQANCHMSA-N |
| XLogP | 4.85 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|