C24H21F3N4O3 — CID 156504581
3-(3-cyano-4-fluorophenyl)-1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)urea (PubChem CID 156504581) has the molecular formula C24H21F3N4O3 and a molecular weight of 470.45 g/mol. Its IUPAC name is 3-(3-cyano-4-fluorophenyl)-1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)urea.
| Compound Name | 3-(3-cyano-4-fluorophenyl)-1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 156504581 |
| Molecular Formula | C24H21F3N4O3 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 3-(3-cyano-4-fluorophenyl)-1-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-methylpropyl)urea |
| SMILES | CC(C)CN(C(=O)Nc1ccc(F)c(C#N)c1)[C@H]1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C24H21F3N4O3/c1-12(2)9-31(24(33)29-14-3-4-17(25)13(5-14)8-28)21-11-34-10-20-22(21)15-6-18(26)19(27)7-16(15)23(32)30-20/h3-7,12,21H,9-11H2,1-2H3,(H,29,33)(H,30,32)/t21-/m0/s1 |
| InChIKey | ZVHQDCRLMSGPSX-NRFANRHFSA-N |
| XLogP | 4.58 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |