C21H18ClF3N4O5S — CID 156504423
3-(3-chloro-4-fluorophenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-sulfamoylethyl)urea (PubChem CID 156504423) has the molecular formula C21H18ClF3N4O5S and a molecular weight of 530.91 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-sulfamoylethyl)urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-sulfamoylethyl)urea |
|---|---|
| PubChem CID | 156504423 |
| Molecular Formula | C21H18ClF3N4O5S |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1-(2-sulfamoylethyl)urea |
| SMILES | NS(=O)(=O)CCN(C(=O)Nc1ccc(F)c(Cl)c1)[C@@H]1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C21H18ClF3N4O5S/c22-13-5-10(1-2-14(13)23)27-21(31)29(3-4-35(26,32)33)18-9-34-8-17-19(18)11-6-15(24)16(25)7-12(11)20(30)28-17/h1-2,5-7,18H,3-4,8-9H2,(H,27,31)(H,28,30)(H2,26,32,33)/t18-/m1/s1 |
| InChIKey | UNPWZCQBGHRDCR-GOSISDBHSA-N |
| XLogP | 2.99 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |