C20H16ClF2N3O3S — CID 156797174
3-(3-chloro-4-fluorophenyl)-1-[(1S,3R)-8-fluoro-3,6-dioxo-1,2,4,5-tetrahydrothiopyrano[3,4-c]isoquinolin-1-yl]-1-methylurea (PubChem CID 156797174) has the molecular formula C20H16ClF2N3O3S and a molecular weight of 451.88 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[(1S,3R)-8-fluoro-3,6-dioxo-1,2,4,5-tetrahydrothiopyrano[3,4-c]isoquinolin-1-yl]-1-methylurea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[(1S,3R)-8-fluoro-3,6-dioxo-1,2,4,5-tetrahydrothiopyrano[3,4-c]isoquinolin-1-yl]-1-methylurea |
|---|---|
| PubChem CID | 156797174 |
| Molecular Formula | C20H16ClF2N3O3S |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[(1S,3R)-8-fluoro-3,6-dioxo-1,2,4,5-tetrahydrothiopyrano[3,4-c]isoquinolin-1-yl]-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(F)c(Cl)c1)[C@@H]1C[S@@](=O)Cc2[nH]c(=O)c3cc(F)ccc3c21 |
| InChI | InChI=1S/C20H16ClF2N3O3S/c1-26(20(28)24-11-3-5-15(23)14(21)7-11)17-9-30(29)8-16-18(17)12-4-2-10(22)6-13(12)19(27)25-16/h2-7,17H,8-9H2,1H3,(H,24,28)(H,25,27)/t17-,30+/m1/s1 |
| InChIKey | SWNKMRUDSVHTCF-ZQHDKMAOSA-N |
| XLogP | 3.93 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |