C22H25ClFN3O2 — CID 156504364
3-(3-chloro-4-fluorophenyl)-1-ethyl-1-[(1R)-6-oxo-2,3,4,5,7,8,9,10-octahydro-1H-phenanthridin-1-yl]urea (PubChem CID 156504364) has the molecular formula C22H25ClFN3O2 and a molecular weight of 417.91 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-ethyl-1-[(1R)-6-oxo-2,3,4,5,7,8,9,10-octahydro-1H-phenanthridin-1-yl]urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-ethyl-1-[(1R)-6-oxo-2,3,4,5,7,8,9,10-octahydro-1H-phenanthridin-1-yl]urea |
|---|---|
| PubChem CID | 156504364 |
| Molecular Formula | C22H25ClFN3O2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-ethyl-1-[(1R)-6-oxo-2,3,4,5,7,8,9,10-octahydro-1H-phenanthridin-1-yl]urea |
| SMILES | CCN(C(=O)Nc1ccc(F)c(Cl)c1)[C@@H]1CCCc2[nH]c(=O)c3c(c21)CCCC3 |
| InChI | InChI=1S/C22H25ClFN3O2/c1-2-27(22(29)25-13-10-11-17(24)16(23)12-13)19-9-5-8-18-20(19)14-6-3-4-7-15(14)21(28)26-18/h10-12,19H,2-9H2,1H3,(H,25,29)(H,26,28)/t19-/m1/s1 |
| InChIKey | JEAMGCQDRKRWRI-LJQANCHMSA-N |
| XLogP | 4.98 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |