C24H25ClFN3O3 — CID 156504250
3-(3-chloro-4-fluorophenyl)-1-(3-hydroxypropyl)-1-(5-oxo-6,7,8,9,10,11-hexahydrocyclohepta[c]isoquinolin-11-yl)urea (PubChem CID 156504250) has the molecular formula C24H25ClFN3O3 and a molecular weight of 457.93 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-(3-hydroxypropyl)-1-(5-oxo-6,7,8,9,10,11-hexahydrocyclohepta[c]isoquinolin-11-yl)urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-(3-hydroxypropyl)-1-(5-oxo-6,7,8,9,10,11-hexahydrocyclohepta[c]isoquinolin-11-yl)urea |
|---|---|
| PubChem CID | 156504250 |
| Molecular Formula | C24H25ClFN3O3 |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-(3-hydroxypropyl)-1-(5-oxo-6,7,8,9,10,11-hexahydrocyclohepta[c]isoquinolin-11-yl)urea |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)N(CCCO)C1CCCCc2[nH]c(=O)c3ccccc3c21 |
| InChI | InChI=1S/C24H25ClFN3O3/c25-18-14-15(10-11-19(18)26)27-24(32)29(12-5-13-30)21-9-4-3-8-20-22(21)16-6-1-2-7-17(16)23(31)28-20/h1-2,6-7,10-11,14,21,30H,3-5,8-9,12-13H2,(H,27,32)(H,28,31) |
| InChIKey | GLUQNFMNUALIIA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |