C14H9F3N4OS — CID 156507228
4-(1-oxidopyridin-1-ium-3-yl)-N-[6-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-2-amine (PubChem CID 156507228) has the molecular formula C14H9F3N4OS and a molecular weight of 338.31 g/mol. Its IUPAC name is 4-(1-oxidopyridin-1-ium-3-yl)-N-[6-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(1-oxidopyridin-1-ium-3-yl)-N-[6-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 156507228 |
| Molecular Formula | C14H9F3N4OS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-(1-oxidopyridin-1-ium-3-yl)-N-[6-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-2-amine |
| SMILES | [O-][n+]1cccc(-c2csc(Nc3cccc(C(F)(F)F)n3)n2)c1 |
| InChI | InChI=1S/C14H9F3N4OS/c15-14(16,17)11-4-1-5-12(19-11)20-13-18-10(8-23-13)9-3-2-6-21(22)7-9/h1-8H,(H,18,19,20) |
| InChIKey | XFBHYPYKQZBKPW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|