C16H18N3O7S- — CID 156508937
(1E,2R,3S)-4-hydroxy-1-[(2-hydroxybenzoyl)hydrazinylidene]-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate (PubChem CID 156508937) has the molecular formula C16H18N3O7S- and a molecular weight of 396.40 g/mol. Its IUPAC name is (1E,2R,3S)-4-hydroxy-1-[(2-hydroxybenzoyl)hydrazinylidene]-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate.
| Compound Name | (1E,2R,3S)-4-hydroxy-1-[(2-hydroxybenzoyl)hydrazinylidene]-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate |
|---|---|
| PubChem CID | 156508937 |
| Molecular Formula | C16H18N3O7S- |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (1E,2R,3S)-4-hydroxy-1-[(2-hydroxybenzoyl)hydrazinylidene]-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate |
| SMILES | C[C@@H]1CC(=O)N1[C@@H](C(=O)O)[C@](C)(/C=N/NC(=O)c1ccccc1O)S(=O)[O-] |
| InChI | InChI=1S/C16H19N3O7S/c1-9-7-12(21)19(9)13(15(23)24)16(2,27(25)26)8-17-18-14(22)10-5-3-4-6-11(10)20/h3-6,8-9,13,20H,7H2,1-2H3,(H,18,22)(H,23,24)(H,25,26)/p-1/b17-8+/t9-,13+,16+/m1/s1 |
| InChIKey | ZRXZFYDQZNAKGF-SWLVLZEUSA-M |
| XLogP | -0.18 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|