C20H22ClN5O8S — CID 156508988
(2S,3S)-4-[4-[(E)-[(2-chloro-3,4-dihydroxybenzoyl)hydrazinylidene]methyl]imidazol-1-yl]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid (PubChem CID 156508988) has the molecular formula C20H22ClN5O8S and a molecular weight of 527.94 g/mol. Its IUPAC name is (2S,3S)-4-[4-[(E)-[(2-chloro-3,4-dihydroxybenzoyl)hydrazinylidene]methyl]imidazol-1-yl]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid.
| Compound Name | (2S,3S)-4-[4-[(E)-[(2-chloro-3,4-dihydroxybenzoyl)hydrazinylidene]methyl]imidazol-1-yl]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid |
|---|---|
| PubChem CID | 156508988 |
| Molecular Formula | C20H22ClN5O8S |
| Molecular Weight | 527.94 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | (2S,3S)-4-[4-[(E)-[(2-chloro-3,4-dihydroxybenzoyl)hydrazinylidene]methyl]imidazol-1-yl]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid |
| SMILES | C[C@@H]1CC(=O)N1[C@@H](C(=O)O)[C@](C)(Cn1cnc(/C=N/NC(=O)c2ccc(O)c(O)c2Cl)c1)S(=O)O |
| InChI | InChI=1S/C20H22ClN5O8S/c1-10-5-14(28)26(10)17(19(31)32)20(2,35(33)34)8-25-7-11(22-9-25)6-23-24-18(30)12-3-4-13(27)16(29)15(12)21/h3-4,6-7,9-10,17,27,29H,5,8H2,1-2H3,(H,24,30)(H,31,32)(H,33,34)/b23-6+/t10-,17+,20+/m1/s1 |
| InChIKey | OYTRSMHQSDNFEW-TVVFLGOVSA-N |
| XLogP | 0.77 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.94 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|