C18H22ClN3O8S — CID 156508892
(2S,3R,4E)-4-[(2-chloro-3,4-dimethoxybenzoyl)hydrazinylidene]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid (PubChem CID 156508892) has the molecular formula C18H22ClN3O8S and a molecular weight of 475.91 g/mol. Its IUPAC name is (2S,3R,4E)-4-[(2-chloro-3,4-dimethoxybenzoyl)hydrazinylidene]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid.
| Compound Name | (2S,3R,4E)-4-[(2-chloro-3,4-dimethoxybenzoyl)hydrazinylidene]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid |
|---|---|
| PubChem CID | 156508892 |
| Molecular Formula | C18H22ClN3O8S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (2S,3R,4E)-4-[(2-chloro-3,4-dimethoxybenzoyl)hydrazinylidene]-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfinobutanoic acid |
| SMILES | COc1ccc(C(=O)N/N=C/[C@@](C)([C@H](C(=O)O)N2C(=O)C[C@H]2C)S(=O)O)c(Cl)c1OC |
| InChI | InChI=1S/C18H22ClN3O8S/c1-9-7-12(23)22(9)15(17(25)26)18(2,31(27)28)8-20-21-16(24)10-5-6-11(29-3)14(30-4)13(10)19/h5-6,8-9,15H,7H2,1-4H3,(H,21,24)(H,25,26)(H,27,28)/b20-8+/t9-,15+,18+/m1/s1 |
| InChIKey | BYHGRHNUGXCNLR-XHQBGQQZSA-N |
| XLogP | 1.13 |
| TPSA | 154.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|