C42H31N2O2P — CID 156509370
2-dibenzofuran-2-yl-5-[4-(3-dimethylphosphorylphenyl)phenyl]-3,6-diphenylpyrazine (PubChem CID 156509370) has the molecular formula C42H31N2O2P and a molecular weight of 626.70 g/mol. Its IUPAC name is 2-dibenzofuran-2-yl-5-[4-(3-dimethylphosphorylphenyl)phenyl]-3,6-diphenylpyrazine.
| Compound Name | 2-dibenzofuran-2-yl-5-[4-(3-dimethylphosphorylphenyl)phenyl]-3,6-diphenylpyrazine |
|---|---|
| PubChem CID | 156509370 |
| Molecular Formula | C42H31N2O2P |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | 2-dibenzofuran-2-yl-5-[4-(3-dimethylphosphorylphenyl)phenyl]-3,6-diphenylpyrazine |
| SMILES | CP(C)(=O)c1cccc(-c2ccc(-c3nc(-c4ccccc4)c(-c4ccc5oc6ccccc6c5c4)nc3-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C42H31N2O2P/c1-47(2,45)34-17-11-16-32(26-34)28-20-22-31(23-21-28)41-39(29-12-5-3-6-13-29)44-42(40(43-41)30-14-7-4-8-15-30)33-24-25-38-36(27-33)35-18-9-10-19-37(35)46-38/h3-27H,1-2H3 |
| InChIKey | FBAQRLODUHUQRH-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|