C20H23N — CID 156510614
8-cyclohexyl-4-methyl-5,6-dihydrobenzo[h]isoquinoline (PubChem CID 156510614) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 8-cyclohexyl-4-methyl-5,6-dihydrobenzo[h]isoquinoline.
| Compound Name | 8-cyclohexyl-4-methyl-5,6-dihydrobenzo[h]isoquinoline |
|---|---|
| PubChem CID | 156510614 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 8-cyclohexyl-4-methyl-5,6-dihydrobenzo[h]isoquinoline |
| SMILES | Cc1cncc2c1CCc1cc(C3CCCCC3)ccc1-2 |
| InChI | InChI=1S/C20H23N/c1-14-12-21-13-20-18(14)9-8-17-11-16(7-10-19(17)20)15-5-3-2-4-6-15/h7,10-13,15H,2-6,8-9H2,1H3 |
| InChIKey | UNPXUMKPNVGQIB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |