C22H28N2O — CID 156844620
8-cyclooctyl-N,N-dimethyl-6H-isochromeno[3,4-b]pyridin-3-amine (PubChem CID 156844620) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 8-cyclooctyl-N,N-dimethyl-6H-isochromeno[3,4-b]pyridin-3-amine.
| Compound Name | 8-cyclooctyl-N,N-dimethyl-6H-isochromeno[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 156844620 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 8-cyclooctyl-N,N-dimethyl-6H-isochromeno[3,4-b]pyridin-3-amine |
| SMILES | CN(C)c1ccc2c(n1)OCc1cc(C3CCCCCCC3)ccc1-2 |
| InChI | InChI=1S/C22H28N2O/c1-24(2)21-13-12-20-19-11-10-17(14-18(19)15-25-22(20)23-21)16-8-6-4-3-5-7-9-16/h10-14,16H,3-9,15H2,1-2H3 |
| InChIKey | ZJVANRRBGWTHCU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |